5e8d79bf98
TS 3.5 got much stricter on writing changes to objects with varied types [1] so we have to do a bit of typecasting work to convince TS about the types of keys and values that we are setting. Longer term we should think about a better data structure that avoids us having to jump through some hoops but for now I think this is a reasonable step to get us onto 3.5. Same story regarding bindings on `window`: the easiest fix is to cast `window` to `any` for the code that adds to it. I'm sure we can come up with a more type-safe way of doing this in the future. [1]: https://github.com/Microsoft/TypeScript/wiki/Breaking-Changes#fixes-to-unsound-writes-to-indexed-access-types
1393 lines
42 KiB
JavaScript
1393 lines
42 KiB
JavaScript
/**
|
|
* Copyright 2017 Google Inc. All rights reserved.
|
|
*
|
|
* Licensed under the Apache License, Version 2.0 (the "License");
|
|
* you may not use this file except in compliance with the License.
|
|
* You may obtain a copy of the License at
|
|
*
|
|
* http://www.apache.org/licenses/LICENSE-2.0
|
|
*
|
|
* Unless required by applicable law or agreed to in writing, software
|
|
* distributed under the License is distributed on an "AS IS" BASIS,
|
|
* WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
* See the License for the specific language governing permissions and
|
|
* limitations under the License.
|
|
*/
|
|
|
|
const fs = require('fs');
|
|
const EventEmitter = require('events');
|
|
const mime = require('mime');
|
|
const {Events} = require('./Events');
|
|
const {Connection} = require('./Connection');
|
|
const {Dialog} = require('./Dialog');
|
|
const {EmulationManager} = require('./EmulationManager');
|
|
const {FrameManager} = require('./FrameManager');
|
|
const {Keyboard, Mouse, Touchscreen} = require('./Input');
|
|
const Tracing = require('./Tracing');
|
|
const {helper, debugError, assert} = require('./helper');
|
|
const {Coverage} = require('./Coverage');
|
|
const {Worker} = require('./Worker');
|
|
const {createJSHandle} = require('./JSHandle');
|
|
const {Accessibility} = require('./Accessibility');
|
|
const {TimeoutSettings} = require('./TimeoutSettings');
|
|
|
|
const writeFileAsync = helper.promisify(fs.writeFile);
|
|
|
|
class Page extends EventEmitter {
|
|
/**
|
|
* @param {!Puppeteer.CDPSession} client
|
|
* @param {!Puppeteer.Target} target
|
|
* @param {boolean} ignoreHTTPSErrors
|
|
* @param {?Puppeteer.Viewport} defaultViewport
|
|
* @param {!Puppeteer.TaskQueue} screenshotTaskQueue
|
|
* @return {!Promise<!Page>}
|
|
*/
|
|
static async create(client, target, ignoreHTTPSErrors, defaultViewport, screenshotTaskQueue) {
|
|
const page = new Page(client, target, ignoreHTTPSErrors, screenshotTaskQueue);
|
|
await page._initialize();
|
|
if (defaultViewport)
|
|
await page.setViewport(defaultViewport);
|
|
return page;
|
|
}
|
|
|
|
/**
|
|
* @param {!Puppeteer.CDPSession} client
|
|
* @param {!Puppeteer.Target} target
|
|
* @param {boolean} ignoreHTTPSErrors
|
|
* @param {!Puppeteer.TaskQueue} screenshotTaskQueue
|
|
*/
|
|
constructor(client, target, ignoreHTTPSErrors, screenshotTaskQueue) {
|
|
super();
|
|
this._closed = false;
|
|
this._client = client;
|
|
this._target = target;
|
|
this._keyboard = new Keyboard(client);
|
|
this._mouse = new Mouse(client, this._keyboard);
|
|
this._timeoutSettings = new TimeoutSettings();
|
|
this._touchscreen = new Touchscreen(client, this._keyboard);
|
|
this._accessibility = new Accessibility(client);
|
|
/** @type {!FrameManager} */
|
|
this._frameManager = new FrameManager(client, this, ignoreHTTPSErrors, this._timeoutSettings);
|
|
this._emulationManager = new EmulationManager(client);
|
|
this._tracing = new Tracing(client);
|
|
/** @type {!Map<string, Function>} */
|
|
this._pageBindings = new Map();
|
|
this._coverage = new Coverage(client);
|
|
this._javascriptEnabled = true;
|
|
/** @type {?Puppeteer.Viewport} */
|
|
this._viewport = null;
|
|
|
|
this._screenshotTaskQueue = screenshotTaskQueue;
|
|
|
|
/** @type {!Map<string, Worker>} */
|
|
this._workers = new Map();
|
|
client.on('Target.attachedToTarget', event => {
|
|
if (event.targetInfo.type !== 'worker') {
|
|
// If we don't detach from service workers, they will never die.
|
|
client.send('Target.detachFromTarget', {
|
|
sessionId: event.sessionId
|
|
}).catch(debugError);
|
|
return;
|
|
}
|
|
const session = Connection.fromSession(client).session(event.sessionId);
|
|
const worker = new Worker(session, event.targetInfo.url, this._addConsoleMessage.bind(this), this._handleException.bind(this));
|
|
this._workers.set(event.sessionId, worker);
|
|
this.emit(Events.Page.WorkerCreated, worker);
|
|
});
|
|
client.on('Target.detachedFromTarget', event => {
|
|
const worker = this._workers.get(event.sessionId);
|
|
if (!worker)
|
|
return;
|
|
this.emit(Events.Page.WorkerDestroyed, worker);
|
|
this._workers.delete(event.sessionId);
|
|
});
|
|
|
|
this._frameManager.on(Events.FrameManager.FrameAttached, event => this.emit(Events.Page.FrameAttached, event));
|
|
this._frameManager.on(Events.FrameManager.FrameDetached, event => this.emit(Events.Page.FrameDetached, event));
|
|
this._frameManager.on(Events.FrameManager.FrameNavigated, event => this.emit(Events.Page.FrameNavigated, event));
|
|
|
|
const networkManager = this._frameManager.networkManager();
|
|
networkManager.on(Events.NetworkManager.Request, event => this.emit(Events.Page.Request, event));
|
|
networkManager.on(Events.NetworkManager.Response, event => this.emit(Events.Page.Response, event));
|
|
networkManager.on(Events.NetworkManager.RequestFailed, event => this.emit(Events.Page.RequestFailed, event));
|
|
networkManager.on(Events.NetworkManager.RequestFinished, event => this.emit(Events.Page.RequestFinished, event));
|
|
this._fileChooserInterceptors = new Set();
|
|
|
|
client.on('Page.domContentEventFired', event => this.emit(Events.Page.DOMContentLoaded));
|
|
client.on('Page.loadEventFired', event => this.emit(Events.Page.Load));
|
|
client.on('Runtime.consoleAPICalled', event => this._onConsoleAPI(event));
|
|
client.on('Runtime.bindingCalled', event => this._onBindingCalled(event));
|
|
client.on('Page.javascriptDialogOpening', event => this._onDialog(event));
|
|
client.on('Runtime.exceptionThrown', exception => this._handleException(exception.exceptionDetails));
|
|
client.on('Inspector.targetCrashed', event => this._onTargetCrashed());
|
|
client.on('Performance.metrics', event => this._emitMetrics(event));
|
|
client.on('Log.entryAdded', event => this._onLogEntryAdded(event));
|
|
client.on('Page.fileChooserOpened', event => this._onFileChooser(event));
|
|
this._target._isClosedPromise.then(() => {
|
|
this.emit(Events.Page.Close);
|
|
this._closed = true;
|
|
});
|
|
}
|
|
|
|
async _initialize() {
|
|
await Promise.all([
|
|
this._frameManager.initialize(),
|
|
this._client.send('Target.setAutoAttach', {autoAttach: true, waitForDebuggerOnStart: false, flatten: true}),
|
|
this._client.send('Performance.enable', {}),
|
|
this._client.send('Log.enable', {}),
|
|
]);
|
|
}
|
|
|
|
/**
|
|
* @param {!Protocol.Page.fileChooserOpenedPayload} event
|
|
*/
|
|
async _onFileChooser(event) {
|
|
if (!this._fileChooserInterceptors.size)
|
|
return;
|
|
const frame = this._frameManager.frame(event.frameId);
|
|
const context = await frame.executionContext();
|
|
const element = await context._adoptBackendNodeId(event.backendNodeId);
|
|
const interceptors = Array.from(this._fileChooserInterceptors);
|
|
this._fileChooserInterceptors.clear();
|
|
const fileChooser = new FileChooser(this._client, element, event);
|
|
for (const interceptor of interceptors)
|
|
interceptor.call(null, fileChooser);
|
|
}
|
|
|
|
/**
|
|
* @param {!{timeout?: number}=} options
|
|
* @return !Promise<!FileChooser>}
|
|
*/
|
|
async waitForFileChooser(options = {}) {
|
|
if (!this._fileChooserInterceptors.size)
|
|
await this._client.send('Page.setInterceptFileChooserDialog', {enabled: true});
|
|
|
|
const {
|
|
timeout = this._timeoutSettings.timeout(),
|
|
} = options;
|
|
let callback;
|
|
const promise = new Promise(x => callback = x);
|
|
this._fileChooserInterceptors.add(callback);
|
|
return helper.waitWithTimeout(promise, 'waiting for file chooser', timeout).catch(e => {
|
|
this._fileChooserInterceptors.delete(callback);
|
|
throw e;
|
|
});
|
|
}
|
|
|
|
/**
|
|
* @param {!{longitude: number, latitude: number, accuracy: (number|undefined)}} options
|
|
*/
|
|
async setGeolocation(options) {
|
|
const { longitude, latitude, accuracy = 0} = options;
|
|
if (longitude < -180 || longitude > 180)
|
|
throw new Error(`Invalid longitude "${longitude}": precondition -180 <= LONGITUDE <= 180 failed.`);
|
|
if (latitude < -90 || latitude > 90)
|
|
throw new Error(`Invalid latitude "${latitude}": precondition -90 <= LATITUDE <= 90 failed.`);
|
|
if (accuracy < 0)
|
|
throw new Error(`Invalid accuracy "${accuracy}": precondition 0 <= ACCURACY failed.`);
|
|
await this._client.send('Emulation.setGeolocationOverride', {longitude, latitude, accuracy});
|
|
}
|
|
|
|
/**
|
|
* @return {!Puppeteer.Target}
|
|
*/
|
|
target() {
|
|
return this._target;
|
|
}
|
|
|
|
/**
|
|
* @return {!Puppeteer.Browser}
|
|
*/
|
|
browser() {
|
|
return this._target.browser();
|
|
}
|
|
|
|
/**
|
|
* @return {!Puppeteer.BrowserContext}
|
|
*/
|
|
browserContext() {
|
|
return this._target.browserContext();
|
|
}
|
|
|
|
_onTargetCrashed() {
|
|
this.emit('error', new Error('Page crashed!'));
|
|
}
|
|
|
|
/**
|
|
* @param {!Protocol.Log.entryAddedPayload} event
|
|
*/
|
|
_onLogEntryAdded(event) {
|
|
const {level, text, args, source, url, lineNumber} = event.entry;
|
|
if (args)
|
|
args.map(arg => helper.releaseObject(this._client, arg));
|
|
if (source !== 'worker')
|
|
this.emit(Events.Page.Console, new ConsoleMessage(level, text, [], {url, lineNumber}));
|
|
}
|
|
|
|
/**
|
|
* @return {!Puppeteer.Frame}
|
|
*/
|
|
mainFrame() {
|
|
return this._frameManager.mainFrame();
|
|
}
|
|
|
|
/**
|
|
* @return {!Keyboard}
|
|
*/
|
|
get keyboard() {
|
|
return this._keyboard;
|
|
}
|
|
|
|
/**
|
|
* @return {!Touchscreen}
|
|
*/
|
|
get touchscreen() {
|
|
return this._touchscreen;
|
|
}
|
|
|
|
/**
|
|
* @return {!Coverage}
|
|
*/
|
|
get coverage() {
|
|
return this._coverage;
|
|
}
|
|
|
|
/**
|
|
* @return {!Tracing}
|
|
*/
|
|
get tracing() {
|
|
return this._tracing;
|
|
}
|
|
|
|
/**
|
|
* @return {!Accessibility}
|
|
*/
|
|
get accessibility() {
|
|
return this._accessibility;
|
|
}
|
|
|
|
/**
|
|
* @return {!Array<Puppeteer.Frame>}
|
|
*/
|
|
frames() {
|
|
return this._frameManager.frames();
|
|
}
|
|
|
|
/**
|
|
* @return {!Array<!Worker>}
|
|
*/
|
|
workers() {
|
|
return Array.from(this._workers.values());
|
|
}
|
|
|
|
/**
|
|
* @param {boolean} value
|
|
*/
|
|
async setRequestInterception(value) {
|
|
return this._frameManager.networkManager().setRequestInterception(value);
|
|
}
|
|
|
|
/**
|
|
* @param {boolean} enabled
|
|
*/
|
|
setOfflineMode(enabled) {
|
|
return this._frameManager.networkManager().setOfflineMode(enabled);
|
|
}
|
|
|
|
/**
|
|
* @param {number} timeout
|
|
*/
|
|
setDefaultNavigationTimeout(timeout) {
|
|
this._timeoutSettings.setDefaultNavigationTimeout(timeout);
|
|
}
|
|
|
|
/**
|
|
* @param {number} timeout
|
|
*/
|
|
setDefaultTimeout(timeout) {
|
|
this._timeoutSettings.setDefaultTimeout(timeout);
|
|
}
|
|
|
|
/**
|
|
* @param {string} selector
|
|
* @return {!Promise<?Puppeteer.ElementHandle>}
|
|
*/
|
|
async $(selector) {
|
|
return this.mainFrame().$(selector);
|
|
}
|
|
|
|
/**
|
|
* @param {Function|string} pageFunction
|
|
* @param {!Array<*>} args
|
|
* @return {!Promise<!Puppeteer.JSHandle>}
|
|
*/
|
|
async evaluateHandle(pageFunction, ...args) {
|
|
const context = await this.mainFrame().executionContext();
|
|
return context.evaluateHandle(pageFunction, ...args);
|
|
}
|
|
|
|
/**
|
|
* @param {!Puppeteer.JSHandle} prototypeHandle
|
|
* @return {!Promise<!Puppeteer.JSHandle>}
|
|
*/
|
|
async queryObjects(prototypeHandle) {
|
|
const context = await this.mainFrame().executionContext();
|
|
return context.queryObjects(prototypeHandle);
|
|
}
|
|
|
|
/**
|
|
* @param {string} selector
|
|
* @param {Function|string} pageFunction
|
|
* @param {!Array<*>} args
|
|
* @return {!Promise<(!Object|undefined)>}
|
|
*/
|
|
async $eval(selector, pageFunction, ...args) {
|
|
return this.mainFrame().$eval(selector, pageFunction, ...args);
|
|
}
|
|
|
|
/**
|
|
* @param {string} selector
|
|
* @param {Function|string} pageFunction
|
|
* @param {!Array<*>} args
|
|
* @return {!Promise<(!Object|undefined)>}
|
|
*/
|
|
async $$eval(selector, pageFunction, ...args) {
|
|
return this.mainFrame().$$eval(selector, pageFunction, ...args);
|
|
}
|
|
|
|
/**
|
|
* @param {string} selector
|
|
* @return {!Promise<!Array<!Puppeteer.ElementHandle>>}
|
|
*/
|
|
async $$(selector) {
|
|
return this.mainFrame().$$(selector);
|
|
}
|
|
|
|
/**
|
|
* @param {string} expression
|
|
* @return {!Promise<!Array<!Puppeteer.ElementHandle>>}
|
|
*/
|
|
async $x(expression) {
|
|
return this.mainFrame().$x(expression);
|
|
}
|
|
|
|
/**
|
|
* @param {!Array<string>} urls
|
|
* @return {!Promise<!Array<Network.Cookie>>}
|
|
*/
|
|
async cookies(...urls) {
|
|
return (await this._client.send('Network.getCookies', {
|
|
urls: urls.length ? urls : [this.url()]
|
|
})).cookies;
|
|
}
|
|
|
|
/**
|
|
* @param {Array<Protocol.Network.deleteCookiesParameters>} cookies
|
|
*/
|
|
async deleteCookie(...cookies) {
|
|
const pageURL = this.url();
|
|
for (const cookie of cookies) {
|
|
const item = Object.assign({}, cookie);
|
|
if (!cookie.url && pageURL.startsWith('http'))
|
|
item.url = pageURL;
|
|
await this._client.send('Network.deleteCookies', item);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @param {Array<Network.CookieParam>} cookies
|
|
*/
|
|
async setCookie(...cookies) {
|
|
const pageURL = this.url();
|
|
const startsWithHTTP = pageURL.startsWith('http');
|
|
const items = cookies.map(cookie => {
|
|
const item = Object.assign({}, cookie);
|
|
if (!item.url && startsWithHTTP)
|
|
item.url = pageURL;
|
|
assert(item.url !== 'about:blank', `Blank page can not have cookie "${item.name}"`);
|
|
assert(!String.prototype.startsWith.call(item.url || '', 'data:'), `Data URL page can not have cookie "${item.name}"`);
|
|
return item;
|
|
});
|
|
await this.deleteCookie(...items);
|
|
if (items.length)
|
|
await this._client.send('Network.setCookies', { cookies: items });
|
|
}
|
|
|
|
/**
|
|
* @param {!{url?: string, path?: string, content?: string, type?: string}} options
|
|
* @return {!Promise<!Puppeteer.ElementHandle>}
|
|
*/
|
|
async addScriptTag(options) {
|
|
return this.mainFrame().addScriptTag(options);
|
|
}
|
|
|
|
/**
|
|
* @param {!{url?: string, path?: string, content?: string}} options
|
|
* @return {!Promise<!Puppeteer.ElementHandle>}
|
|
*/
|
|
async addStyleTag(options) {
|
|
return this.mainFrame().addStyleTag(options);
|
|
}
|
|
|
|
/**
|
|
* @param {string} name
|
|
* @param {Function} puppeteerFunction
|
|
*/
|
|
async exposeFunction(name, puppeteerFunction) {
|
|
if (this._pageBindings.has(name))
|
|
throw new Error(`Failed to add page binding with name ${name}: window['${name}'] already exists!`);
|
|
this._pageBindings.set(name, puppeteerFunction);
|
|
|
|
const expression = helper.evaluationString(addPageBinding, name);
|
|
await this._client.send('Runtime.addBinding', {name: name});
|
|
await this._client.send('Page.addScriptToEvaluateOnNewDocument', {source: expression});
|
|
await Promise.all(this.frames().map(frame => frame.evaluate(expression).catch(debugError)));
|
|
|
|
function addPageBinding(bindingName) {
|
|
const win = /** @type * */ (window);
|
|
const binding = /** @type function(string):* */ (win[bindingName]);
|
|
|
|
win[bindingName] = (...args) => {
|
|
const me = window[bindingName];
|
|
let callbacks = me['callbacks'];
|
|
if (!callbacks) {
|
|
callbacks = new Map();
|
|
me['callbacks'] = callbacks;
|
|
}
|
|
const seq = (me['lastSeq'] || 0) + 1;
|
|
me['lastSeq'] = seq;
|
|
const promise = new Promise((resolve, reject) => callbacks.set(seq, {resolve, reject}));
|
|
binding(JSON.stringify({name: bindingName, seq, args}));
|
|
return promise;
|
|
};
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @param {?{username: string, password: string}} credentials
|
|
*/
|
|
async authenticate(credentials) {
|
|
return this._frameManager.networkManager().authenticate(credentials);
|
|
}
|
|
|
|
/**
|
|
* @param {!Object<string, string>} headers
|
|
*/
|
|
async setExtraHTTPHeaders(headers) {
|
|
return this._frameManager.networkManager().setExtraHTTPHeaders(headers);
|
|
}
|
|
|
|
/**
|
|
* @param {string} userAgent
|
|
*/
|
|
async setUserAgent(userAgent) {
|
|
return this._frameManager.networkManager().setUserAgent(userAgent);
|
|
}
|
|
|
|
/**
|
|
* @return {!Promise<!Metrics>}
|
|
*/
|
|
async metrics() {
|
|
const response = await this._client.send('Performance.getMetrics');
|
|
return this._buildMetricsObject(response.metrics);
|
|
}
|
|
|
|
/**
|
|
* @param {!Protocol.Performance.metricsPayload} event
|
|
*/
|
|
_emitMetrics(event) {
|
|
this.emit(Events.Page.Metrics, {
|
|
title: event.title,
|
|
metrics: this._buildMetricsObject(event.metrics)
|
|
});
|
|
}
|
|
|
|
/**
|
|
* @param {?Array<!Protocol.Performance.Metric>} metrics
|
|
* @return {!Metrics}
|
|
*/
|
|
_buildMetricsObject(metrics) {
|
|
const result = {};
|
|
for (const metric of metrics || []) {
|
|
if (supportedMetrics.has(metric.name))
|
|
result[metric.name] = metric.value;
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* @param {!Protocol.Runtime.ExceptionDetails} exceptionDetails
|
|
*/
|
|
_handleException(exceptionDetails) {
|
|
const message = helper.getExceptionMessage(exceptionDetails);
|
|
const err = new Error(message);
|
|
err.stack = ''; // Don't report clientside error with a node stack attached
|
|
this.emit(Events.Page.PageError, err);
|
|
}
|
|
|
|
/**
|
|
* @param {!Protocol.Runtime.consoleAPICalledPayload} event
|
|
*/
|
|
async _onConsoleAPI(event) {
|
|
if (event.executionContextId === 0) {
|
|
// DevTools protocol stores the last 1000 console messages. These
|
|
// messages are always reported even for removed execution contexts. In
|
|
// this case, they are marked with executionContextId = 0 and are
|
|
// reported upon enabling Runtime agent.
|
|
//
|
|
// Ignore these messages since:
|
|
// - there's no execution context we can use to operate with message
|
|
// arguments
|
|
// - these messages are reported before Puppeteer clients can subscribe
|
|
// to the 'console'
|
|
// page event.
|
|
//
|
|
// @see https://github.com/puppeteer/puppeteer/issues/3865
|
|
return;
|
|
}
|
|
const context = this._frameManager.executionContextById(event.executionContextId);
|
|
const values = event.args.map(arg => createJSHandle(context, arg));
|
|
this._addConsoleMessage(event.type, values, event.stackTrace);
|
|
}
|
|
|
|
/**
|
|
* @param {!Protocol.Runtime.bindingCalledPayload} event
|
|
*/
|
|
async _onBindingCalled(event) {
|
|
const {name, seq, args} = JSON.parse(event.payload);
|
|
let expression = null;
|
|
try {
|
|
const result = await this._pageBindings.get(name)(...args);
|
|
expression = helper.evaluationString(deliverResult, name, seq, result);
|
|
} catch (error) {
|
|
if (error instanceof Error)
|
|
expression = helper.evaluationString(deliverError, name, seq, error.message, error.stack);
|
|
else
|
|
expression = helper.evaluationString(deliverErrorValue, name, seq, error);
|
|
}
|
|
this._client.send('Runtime.evaluate', { expression, contextId: event.executionContextId }).catch(debugError);
|
|
|
|
/**
|
|
* @param {string} name
|
|
* @param {number} seq
|
|
* @param {*} result
|
|
*/
|
|
function deliverResult(name, seq, result) {
|
|
window[name]['callbacks'].get(seq).resolve(result);
|
|
window[name]['callbacks'].delete(seq);
|
|
}
|
|
|
|
/**
|
|
* @param {string} name
|
|
* @param {number} seq
|
|
* @param {string} message
|
|
* @param {string} stack
|
|
*/
|
|
function deliverError(name, seq, message, stack) {
|
|
const error = new Error(message);
|
|
error.stack = stack;
|
|
window[name]['callbacks'].get(seq).reject(error);
|
|
window[name]['callbacks'].delete(seq);
|
|
}
|
|
|
|
/**
|
|
* @param {string} name
|
|
* @param {number} seq
|
|
* @param {*} value
|
|
*/
|
|
function deliverErrorValue(name, seq, value) {
|
|
window[name]['callbacks'].get(seq).reject(value);
|
|
window[name]['callbacks'].delete(seq);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @param {string} type
|
|
* @param {!Array<!Puppeteer.JSHandle>} args
|
|
* @param {Protocol.Runtime.StackTrace=} stackTrace
|
|
*/
|
|
_addConsoleMessage(type, args, stackTrace) {
|
|
if (!this.listenerCount(Events.Page.Console)) {
|
|
args.forEach(arg => arg.dispose());
|
|
return;
|
|
}
|
|
const textTokens = [];
|
|
for (const arg of args) {
|
|
const remoteObject = arg._remoteObject;
|
|
if (remoteObject.objectId)
|
|
textTokens.push(arg.toString());
|
|
else
|
|
textTokens.push(helper.valueFromRemoteObject(remoteObject));
|
|
}
|
|
const location = stackTrace && stackTrace.callFrames.length ? {
|
|
url: stackTrace.callFrames[0].url,
|
|
lineNumber: stackTrace.callFrames[0].lineNumber,
|
|
columnNumber: stackTrace.callFrames[0].columnNumber,
|
|
} : {};
|
|
const message = new ConsoleMessage(type, textTokens.join(' '), args, location);
|
|
this.emit(Events.Page.Console, message);
|
|
}
|
|
|
|
_onDialog(event) {
|
|
let dialogType = null;
|
|
if (event.type === 'alert')
|
|
dialogType = Dialog.Type.Alert;
|
|
else if (event.type === 'confirm')
|
|
dialogType = Dialog.Type.Confirm;
|
|
else if (event.type === 'prompt')
|
|
dialogType = Dialog.Type.Prompt;
|
|
else if (event.type === 'beforeunload')
|
|
dialogType = Dialog.Type.BeforeUnload;
|
|
assert(dialogType, 'Unknown javascript dialog type: ' + event.type);
|
|
const dialog = new Dialog(this._client, dialogType, event.message, event.defaultPrompt);
|
|
this.emit(Events.Page.Dialog, dialog);
|
|
}
|
|
|
|
/**
|
|
* @return {!string}
|
|
*/
|
|
url() {
|
|
return this.mainFrame().url();
|
|
}
|
|
|
|
/**
|
|
* @return {!Promise<string>}
|
|
*/
|
|
async content() {
|
|
return await this._frameManager.mainFrame().content();
|
|
}
|
|
|
|
/**
|
|
* @param {string} html
|
|
* @param {!{timeout?: number, waitUntil?: string|!Array<string>}=} options
|
|
*/
|
|
async setContent(html, options) {
|
|
await this._frameManager.mainFrame().setContent(html, options);
|
|
}
|
|
|
|
/**
|
|
* @param {string} url
|
|
* @param {!{referer?: string, timeout?: number, waitUntil?: string|!Array<string>}=} options
|
|
* @return {!Promise<?Puppeteer.Response>}
|
|
*/
|
|
async goto(url, options) {
|
|
return await this._frameManager.mainFrame().goto(url, options);
|
|
}
|
|
|
|
/**
|
|
* @param {!{timeout?: number, waitUntil?: string|!Array<string>}=} options
|
|
* @return {!Promise<?Puppeteer.Response>}
|
|
*/
|
|
async reload(options) {
|
|
const result = await Promise.all([
|
|
this.waitForNavigation(options),
|
|
this._client.send('Page.reload')
|
|
]);
|
|
|
|
const response = /** @type Puppeteer.Response */ (result[0]);
|
|
return response;
|
|
}
|
|
|
|
/**
|
|
* @param {!{timeout?: number, waitUntil?: string|!Array<string>}=} options
|
|
* @return {!Promise<?Puppeteer.Response>}
|
|
*/
|
|
async waitForNavigation(options = {}) {
|
|
return await this._frameManager.mainFrame().waitForNavigation(options);
|
|
}
|
|
|
|
_sessionClosePromise() {
|
|
if (!this._disconnectPromise)
|
|
this._disconnectPromise = new Promise(fulfill => this._client.once(Events.CDPSession.Disconnected, () => fulfill(new Error('Target closed'))));
|
|
return this._disconnectPromise;
|
|
}
|
|
|
|
/**
|
|
* @param {(string|Function)} urlOrPredicate
|
|
* @param {!{timeout?: number}=} options
|
|
* @return {!Promise<!Puppeteer.Request>}
|
|
*/
|
|
async waitForRequest(urlOrPredicate, options = {}) {
|
|
const {
|
|
timeout = this._timeoutSettings.timeout(),
|
|
} = options;
|
|
return helper.waitForEvent(this._frameManager.networkManager(), Events.NetworkManager.Request, request => {
|
|
if (helper.isString(urlOrPredicate))
|
|
return (urlOrPredicate === request.url());
|
|
if (typeof urlOrPredicate === 'function')
|
|
return !!(urlOrPredicate(request));
|
|
return false;
|
|
}, timeout, this._sessionClosePromise());
|
|
}
|
|
|
|
/**
|
|
* @param {(string|Function)} urlOrPredicate
|
|
* @param {!{timeout?: number}=} options
|
|
* @return {!Promise<!Puppeteer.Response>}
|
|
*/
|
|
async waitForResponse(urlOrPredicate, options = {}) {
|
|
const {
|
|
timeout = this._timeoutSettings.timeout(),
|
|
} = options;
|
|
return helper.waitForEvent(this._frameManager.networkManager(), Events.NetworkManager.Response, response => {
|
|
if (helper.isString(urlOrPredicate))
|
|
return (urlOrPredicate === response.url());
|
|
if (typeof urlOrPredicate === 'function')
|
|
return !!(urlOrPredicate(response));
|
|
return false;
|
|
}, timeout, this._sessionClosePromise());
|
|
}
|
|
|
|
/**
|
|
* @param {!{timeout?: number, waitUntil?: string|!Array<string>}=} options
|
|
* @return {!Promise<?Puppeteer.Response>}
|
|
*/
|
|
async goBack(options) {
|
|
return this._go(-1, options);
|
|
}
|
|
|
|
/**
|
|
* @param {!{timeout?: number, waitUntil?: string|!Array<string>}=} options
|
|
* @return {!Promise<?Puppeteer.Response>}
|
|
*/
|
|
async goForward(options) {
|
|
return this._go(+1, options);
|
|
}
|
|
|
|
/**
|
|
* @param {!{timeout?: number, waitUntil?: string|!Array<string>}=} options
|
|
* @return {!Promise<?Puppeteer.Response>}
|
|
*/
|
|
async _go(delta, options) {
|
|
const history = await this._client.send('Page.getNavigationHistory');
|
|
const entry = history.entries[history.currentIndex + delta];
|
|
if (!entry)
|
|
return null;
|
|
const result = await Promise.all([
|
|
this.waitForNavigation(options),
|
|
this._client.send('Page.navigateToHistoryEntry', {entryId: entry.id}),
|
|
]);
|
|
const response = /** @type Puppeteer.Response */ (result[0]);
|
|
return response;
|
|
}
|
|
|
|
async bringToFront() {
|
|
await this._client.send('Page.bringToFront');
|
|
}
|
|
|
|
/**
|
|
* @param {!{viewport: !Puppeteer.Viewport, userAgent: string}} options
|
|
*/
|
|
async emulate(options) {
|
|
await Promise.all([
|
|
this.setViewport(options.viewport),
|
|
this.setUserAgent(options.userAgent)
|
|
]);
|
|
}
|
|
|
|
/**
|
|
* @param {boolean} enabled
|
|
*/
|
|
async setJavaScriptEnabled(enabled) {
|
|
if (this._javascriptEnabled === enabled)
|
|
return;
|
|
this._javascriptEnabled = enabled;
|
|
await this._client.send('Emulation.setScriptExecutionDisabled', { value: !enabled });
|
|
}
|
|
|
|
/**
|
|
* @param {boolean} enabled
|
|
*/
|
|
async setBypassCSP(enabled) {
|
|
await this._client.send('Page.setBypassCSP', { enabled });
|
|
}
|
|
|
|
/**
|
|
* @param {?string} type
|
|
*/
|
|
async emulateMediaType(type) {
|
|
assert(type === 'screen' || type === 'print' || type === null, 'Unsupported media type: ' + type);
|
|
await this._client.send('Emulation.setEmulatedMedia', {media: type || ''});
|
|
}
|
|
|
|
/**
|
|
* @param {?Array<MediaFeature>} features
|
|
*/
|
|
async emulateMediaFeatures(features) {
|
|
if (features === null)
|
|
await this._client.send('Emulation.setEmulatedMedia', {features: null});
|
|
if (Array.isArray(features)) {
|
|
features.every(mediaFeature => {
|
|
const name = mediaFeature.name;
|
|
assert(/^prefers-(?:color-scheme|reduced-motion)$/.test(name), 'Unsupported media feature: ' + name);
|
|
return true;
|
|
});
|
|
await this._client.send('Emulation.setEmulatedMedia', {features: features});
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @param {?string} timezoneId
|
|
*/
|
|
async emulateTimezone(timezoneId) {
|
|
try {
|
|
await this._client.send('Emulation.setTimezoneOverride', {timezoneId: timezoneId || ''});
|
|
} catch (exception) {
|
|
if (exception.message.includes('Invalid timezone'))
|
|
throw new Error(`Invalid timezone ID: ${timezoneId}`);
|
|
throw exception;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @param {!Puppeteer.Viewport} viewport
|
|
*/
|
|
async setViewport(viewport) {
|
|
const needsReload = await this._emulationManager.emulateViewport(viewport);
|
|
this._viewport = viewport;
|
|
if (needsReload)
|
|
await this.reload();
|
|
}
|
|
|
|
/**
|
|
* @return {?Puppeteer.Viewport}
|
|
*/
|
|
viewport() {
|
|
return this._viewport;
|
|
}
|
|
|
|
/**
|
|
* @param {Function|string} pageFunction
|
|
* @param {!Array<*>} args
|
|
* @return {!Promise<*>}
|
|
*/
|
|
async evaluate(pageFunction, ...args) {
|
|
return this._frameManager.mainFrame().evaluate(pageFunction, ...args);
|
|
}
|
|
|
|
/**
|
|
* @param {Function|string} pageFunction
|
|
* @param {!Array<*>} args
|
|
*/
|
|
async evaluateOnNewDocument(pageFunction, ...args) {
|
|
const source = helper.evaluationString(pageFunction, ...args);
|
|
await this._client.send('Page.addScriptToEvaluateOnNewDocument', { source });
|
|
}
|
|
|
|
/**
|
|
* @param {boolean} enabled
|
|
*/
|
|
async setCacheEnabled(enabled = true) {
|
|
await this._frameManager.networkManager().setCacheEnabled(enabled);
|
|
}
|
|
|
|
/**
|
|
* @param {!ScreenshotOptions=} options
|
|
* @return {!Promise<!Buffer|!String>}
|
|
*/
|
|
async screenshot(options = {}) {
|
|
let screenshotType = null;
|
|
// options.type takes precedence over inferring the type from options.path
|
|
// because it may be a 0-length file with no extension created beforehand (i.e. as a temp file).
|
|
if (options.type) {
|
|
assert(options.type === 'png' || options.type === 'jpeg', 'Unknown options.type value: ' + options.type);
|
|
screenshotType = options.type;
|
|
} else if (options.path) {
|
|
const mimeType = mime.getType(options.path);
|
|
if (mimeType === 'image/png')
|
|
screenshotType = 'png';
|
|
else if (mimeType === 'image/jpeg')
|
|
screenshotType = 'jpeg';
|
|
assert(screenshotType, 'Unsupported screenshot mime type: ' + mimeType);
|
|
}
|
|
|
|
if (!screenshotType)
|
|
screenshotType = 'png';
|
|
|
|
if (options.quality) {
|
|
assert(screenshotType === 'jpeg', 'options.quality is unsupported for the ' + screenshotType + ' screenshots');
|
|
assert(typeof options.quality === 'number', 'Expected options.quality to be a number but found ' + (typeof options.quality));
|
|
assert(Number.isInteger(options.quality), 'Expected options.quality to be an integer');
|
|
assert(options.quality >= 0 && options.quality <= 100, 'Expected options.quality to be between 0 and 100 (inclusive), got ' + options.quality);
|
|
}
|
|
assert(!options.clip || !options.fullPage, 'options.clip and options.fullPage are exclusive');
|
|
if (options.clip) {
|
|
assert(typeof options.clip.x === 'number', 'Expected options.clip.x to be a number but found ' + (typeof options.clip.x));
|
|
assert(typeof options.clip.y === 'number', 'Expected options.clip.y to be a number but found ' + (typeof options.clip.y));
|
|
assert(typeof options.clip.width === 'number', 'Expected options.clip.width to be a number but found ' + (typeof options.clip.width));
|
|
assert(typeof options.clip.height === 'number', 'Expected options.clip.height to be a number but found ' + (typeof options.clip.height));
|
|
assert(options.clip.width !== 0, 'Expected options.clip.width not to be 0.');
|
|
assert(options.clip.height !== 0, 'Expected options.clip.height not to be 0.');
|
|
}
|
|
return this._screenshotTaskQueue.postTask(this._screenshotTask.bind(this, screenshotType, options));
|
|
}
|
|
|
|
/**
|
|
* @param {"png"|"jpeg"} format
|
|
* @param {!ScreenshotOptions=} options
|
|
* @return {!Promise<!Buffer|!String>}
|
|
*/
|
|
async _screenshotTask(format, options) {
|
|
await this._client.send('Target.activateTarget', {targetId: this._target._targetId});
|
|
let clip = options.clip ? processClip(options.clip) : undefined;
|
|
|
|
if (options.fullPage) {
|
|
const metrics = await this._client.send('Page.getLayoutMetrics');
|
|
const width = Math.ceil(metrics.contentSize.width);
|
|
const height = Math.ceil(metrics.contentSize.height);
|
|
|
|
// Overwrite clip for full page at all times.
|
|
clip = { x: 0, y: 0, width, height, scale: 1 };
|
|
const {
|
|
isMobile = false,
|
|
deviceScaleFactor = 1,
|
|
isLandscape = false
|
|
} = this._viewport || {};
|
|
/** @type {!Protocol.Emulation.ScreenOrientation} */
|
|
const screenOrientation = isLandscape ? { angle: 90, type: 'landscapePrimary' } : { angle: 0, type: 'portraitPrimary' };
|
|
await this._client.send('Emulation.setDeviceMetricsOverride', { mobile: isMobile, width, height, deviceScaleFactor, screenOrientation });
|
|
}
|
|
const shouldSetDefaultBackground = options.omitBackground && format === 'png';
|
|
if (shouldSetDefaultBackground)
|
|
await this._client.send('Emulation.setDefaultBackgroundColorOverride', { color: { r: 0, g: 0, b: 0, a: 0 } });
|
|
const result = await this._client.send('Page.captureScreenshot', { format, quality: options.quality, clip });
|
|
if (shouldSetDefaultBackground)
|
|
await this._client.send('Emulation.setDefaultBackgroundColorOverride');
|
|
|
|
if (options.fullPage && this._viewport)
|
|
await this.setViewport(this._viewport);
|
|
|
|
const buffer = options.encoding === 'base64' ? result.data : Buffer.from(result.data, 'base64');
|
|
if (options.path)
|
|
await writeFileAsync(options.path, buffer);
|
|
return buffer;
|
|
|
|
function processClip(clip) {
|
|
const x = Math.round(clip.x);
|
|
const y = Math.round(clip.y);
|
|
const width = Math.round(clip.width + clip.x - x);
|
|
const height = Math.round(clip.height + clip.y - y);
|
|
return {x, y, width, height, scale: 1};
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @param {!PDFOptions=} options
|
|
* @return {!Promise<!Buffer>}
|
|
*/
|
|
async pdf(options = {}) {
|
|
const {
|
|
scale = 1,
|
|
displayHeaderFooter = false,
|
|
headerTemplate = '',
|
|
footerTemplate = '',
|
|
printBackground = false,
|
|
landscape = false,
|
|
pageRanges = '',
|
|
preferCSSPageSize = false,
|
|
margin = {},
|
|
path = null
|
|
} = options;
|
|
|
|
let paperWidth = 8.5;
|
|
let paperHeight = 11;
|
|
if (options.format) {
|
|
const format = Page.PaperFormats[options.format.toLowerCase()];
|
|
assert(format, 'Unknown paper format: ' + options.format);
|
|
paperWidth = format.width;
|
|
paperHeight = format.height;
|
|
} else {
|
|
paperWidth = convertPrintParameterToInches(options.width) || paperWidth;
|
|
paperHeight = convertPrintParameterToInches(options.height) || paperHeight;
|
|
}
|
|
|
|
const marginTop = convertPrintParameterToInches(margin.top) || 0;
|
|
const marginLeft = convertPrintParameterToInches(margin.left) || 0;
|
|
const marginBottom = convertPrintParameterToInches(margin.bottom) || 0;
|
|
const marginRight = convertPrintParameterToInches(margin.right) || 0;
|
|
|
|
const result = await this._client.send('Page.printToPDF', {
|
|
transferMode: 'ReturnAsStream',
|
|
landscape,
|
|
displayHeaderFooter,
|
|
headerTemplate,
|
|
footerTemplate,
|
|
printBackground,
|
|
scale,
|
|
paperWidth,
|
|
paperHeight,
|
|
marginTop,
|
|
marginBottom,
|
|
marginLeft,
|
|
marginRight,
|
|
pageRanges,
|
|
preferCSSPageSize
|
|
});
|
|
return await helper.readProtocolStream(this._client, result.stream, path);
|
|
}
|
|
|
|
/**
|
|
* @return {!Promise<string>}
|
|
*/
|
|
async title() {
|
|
return this.mainFrame().title();
|
|
}
|
|
|
|
/**
|
|
* @param {!{runBeforeUnload: (boolean|undefined)}=} options
|
|
*/
|
|
async close(options = {runBeforeUnload: undefined}) {
|
|
assert(!!this._client._connection, 'Protocol error: Connection closed. Most likely the page has been closed.');
|
|
const runBeforeUnload = !!options.runBeforeUnload;
|
|
if (runBeforeUnload) {
|
|
await this._client.send('Page.close');
|
|
} else {
|
|
await this._client._connection.send('Target.closeTarget', { targetId: this._target._targetId });
|
|
await this._target._isClosedPromise;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @return {boolean}
|
|
*/
|
|
isClosed() {
|
|
return this._closed;
|
|
}
|
|
|
|
/**
|
|
* @return {!Mouse}
|
|
*/
|
|
get mouse() {
|
|
return this._mouse;
|
|
}
|
|
|
|
/**
|
|
* @param {string} selector
|
|
* @param {!{delay?: number, button?: "left"|"right"|"middle", clickCount?: number}=} options
|
|
*/
|
|
click(selector, options = {}) {
|
|
return this.mainFrame().click(selector, options);
|
|
}
|
|
|
|
/**
|
|
* @param {string} selector
|
|
*/
|
|
focus(selector) {
|
|
return this.mainFrame().focus(selector);
|
|
}
|
|
|
|
/**
|
|
* @param {string} selector
|
|
*/
|
|
hover(selector) {
|
|
return this.mainFrame().hover(selector);
|
|
}
|
|
|
|
/**
|
|
* @param {string} selector
|
|
* @param {!Array<string>} values
|
|
* @return {!Promise<!Array<string>>}
|
|
*/
|
|
select(selector, ...values) {
|
|
return this.mainFrame().select(selector, ...values);
|
|
}
|
|
|
|
/**
|
|
* @param {string} selector
|
|
*/
|
|
tap(selector) {
|
|
return this.mainFrame().tap(selector);
|
|
}
|
|
|
|
/**
|
|
* @param {string} selector
|
|
* @param {string} text
|
|
* @param {{delay: (number|undefined)}=} options
|
|
*/
|
|
type(selector, text, options) {
|
|
return this.mainFrame().type(selector, text, options);
|
|
}
|
|
|
|
/**
|
|
* @param {(string|number|Function)} selectorOrFunctionOrTimeout
|
|
* @param {!{visible?: boolean, hidden?: boolean, timeout?: number, polling?: string|number}=} options
|
|
* @param {!Array<*>} args
|
|
* @return {!Promise<!Puppeteer.JSHandle>}
|
|
*/
|
|
waitFor(selectorOrFunctionOrTimeout, options = {}, ...args) {
|
|
return this.mainFrame().waitFor(selectorOrFunctionOrTimeout, options, ...args);
|
|
}
|
|
|
|
/**
|
|
* @param {string} selector
|
|
* @param {!{visible?: boolean, hidden?: boolean, timeout?: number}=} options
|
|
* @return {!Promise<?Puppeteer.ElementHandle>}
|
|
*/
|
|
waitForSelector(selector, options = {}) {
|
|
return this.mainFrame().waitForSelector(selector, options);
|
|
}
|
|
|
|
/**
|
|
* @param {string} xpath
|
|
* @param {!{visible?: boolean, hidden?: boolean, timeout?: number}=} options
|
|
* @return {!Promise<?Puppeteer.ElementHandle>}
|
|
*/
|
|
waitForXPath(xpath, options = {}) {
|
|
return this.mainFrame().waitForXPath(xpath, options);
|
|
}
|
|
|
|
/**
|
|
* @param {Function} pageFunction
|
|
* @param {!{polling?: string|number, timeout?: number}=} options
|
|
* @param {!Array<*>} args
|
|
* @return {!Promise<!Puppeteer.JSHandle>}
|
|
*/
|
|
waitForFunction(pageFunction, options = {}, ...args) {
|
|
return this.mainFrame().waitForFunction(pageFunction, options, ...args);
|
|
}
|
|
}
|
|
|
|
// Expose alias for deprecated method.
|
|
Page.prototype.emulateMedia = Page.prototype.emulateMediaType;
|
|
|
|
/**
|
|
* @typedef {Object} PDFOptions
|
|
* @property {number=} scale
|
|
* @property {boolean=} displayHeaderFooter
|
|
* @property {string=} headerTemplate
|
|
* @property {string=} footerTemplate
|
|
* @property {boolean=} printBackground
|
|
* @property {boolean=} landscape
|
|
* @property {string=} pageRanges
|
|
* @property {string=} format
|
|
* @property {string|number=} width
|
|
* @property {string|number=} height
|
|
* @property {boolean=} preferCSSPageSize
|
|
* @property {!{top?: string|number, bottom?: string|number, left?: string|number, right?: string|number}=} margin
|
|
* @property {string=} path
|
|
*/
|
|
|
|
/**
|
|
* @typedef {Object} Metrics
|
|
* @property {number=} Timestamp
|
|
* @property {number=} Documents
|
|
* @property {number=} Frames
|
|
* @property {number=} JSEventListeners
|
|
* @property {number=} Nodes
|
|
* @property {number=} LayoutCount
|
|
* @property {number=} RecalcStyleCount
|
|
* @property {number=} LayoutDuration
|
|
* @property {number=} RecalcStyleDuration
|
|
* @property {number=} ScriptDuration
|
|
* @property {number=} TaskDuration
|
|
* @property {number=} JSHeapUsedSize
|
|
* @property {number=} JSHeapTotalSize
|
|
*/
|
|
|
|
/**
|
|
* @typedef {Object} ScreenshotOptions
|
|
* @property {string=} type
|
|
* @property {string=} path
|
|
* @property {boolean=} fullPage
|
|
* @property {{x: number, y: number, width: number, height: number}=} clip
|
|
* @property {number=} quality
|
|
* @property {boolean=} omitBackground
|
|
* @property {string=} encoding
|
|
*/
|
|
|
|
/**
|
|
* @typedef {Object} MediaFeature
|
|
* @property {string} name
|
|
* @property {string} value
|
|
*/
|
|
|
|
/** @type {!Set<string>} */
|
|
const supportedMetrics = new Set([
|
|
'Timestamp',
|
|
'Documents',
|
|
'Frames',
|
|
'JSEventListeners',
|
|
'Nodes',
|
|
'LayoutCount',
|
|
'RecalcStyleCount',
|
|
'LayoutDuration',
|
|
'RecalcStyleDuration',
|
|
'ScriptDuration',
|
|
'TaskDuration',
|
|
'JSHeapUsedSize',
|
|
'JSHeapTotalSize',
|
|
]);
|
|
|
|
/** @enum {!{width: number, height: number}} */
|
|
Page.PaperFormats = {
|
|
letter: {width: 8.5, height: 11},
|
|
legal: {width: 8.5, height: 14},
|
|
tabloid: {width: 11, height: 17},
|
|
ledger: {width: 17, height: 11},
|
|
a0: {width: 33.1, height: 46.8 },
|
|
a1: {width: 23.4, height: 33.1 },
|
|
a2: {width: 16.54, height: 23.4 },
|
|
a3: {width: 11.7, height: 16.54 },
|
|
a4: {width: 8.27, height: 11.7 },
|
|
a5: {width: 5.83, height: 8.27 },
|
|
a6: {width: 4.13, height: 5.83 },
|
|
};
|
|
|
|
const unitToPixels = {
|
|
'px': 1,
|
|
'in': 96,
|
|
'cm': 37.8,
|
|
'mm': 3.78
|
|
};
|
|
|
|
/**
|
|
* @param {(string|number|undefined)} parameter
|
|
* @return {(number|undefined)}
|
|
*/
|
|
function convertPrintParameterToInches(parameter) {
|
|
if (typeof parameter === 'undefined')
|
|
return undefined;
|
|
let pixels;
|
|
if (helper.isNumber(parameter)) {
|
|
// Treat numbers as pixel values to be aligned with phantom's paperSize.
|
|
pixels = /** @type {number} */ (parameter);
|
|
} else if (helper.isString(parameter)) {
|
|
const text = /** @type {string} */ (parameter);
|
|
let unit = text.substring(text.length - 2).toLowerCase();
|
|
let valueText = '';
|
|
if (unitToPixels.hasOwnProperty(unit)) {
|
|
valueText = text.substring(0, text.length - 2);
|
|
} else {
|
|
// In case of unknown unit try to parse the whole parameter as number of pixels.
|
|
// This is consistent with phantom's paperSize behavior.
|
|
unit = 'px';
|
|
valueText = text;
|
|
}
|
|
const value = Number(valueText);
|
|
assert(!isNaN(value), 'Failed to parse parameter value: ' + text);
|
|
pixels = value * unitToPixels[unit];
|
|
} else {
|
|
throw new Error('page.pdf() Cannot handle parameter type: ' + (typeof parameter));
|
|
}
|
|
return pixels / 96;
|
|
}
|
|
|
|
/**
|
|
* @typedef {Object} Network.Cookie
|
|
* @property {string} name
|
|
* @property {string} value
|
|
* @property {string} domain
|
|
* @property {string} path
|
|
* @property {number} expires
|
|
* @property {number} size
|
|
* @property {boolean} httpOnly
|
|
* @property {boolean} secure
|
|
* @property {boolean} session
|
|
* @property {("Strict"|"Lax"|"Extended"|"None")=} sameSite
|
|
*/
|
|
|
|
|
|
/**
|
|
* @typedef {Object} Network.CookieParam
|
|
* @property {string} name
|
|
* @property {string} value
|
|
* @property {string=} url
|
|
* @property {string=} domain
|
|
* @property {string=} path
|
|
* @property {number=} expires
|
|
* @property {boolean=} httpOnly
|
|
* @property {boolean=} secure
|
|
* @property {("Strict"|"Lax")=} sameSite
|
|
*/
|
|
|
|
/**
|
|
* @typedef {Object} ConsoleMessage.Location
|
|
* @property {string=} url
|
|
* @property {number=} lineNumber
|
|
* @property {number=} columnNumber
|
|
*/
|
|
|
|
class ConsoleMessage {
|
|
/**
|
|
* @param {string} type
|
|
* @param {string} text
|
|
* @param {!Array<!Puppeteer.JSHandle>} args
|
|
* @param {ConsoleMessage.Location} location
|
|
*/
|
|
constructor(type, text, args, location = {}) {
|
|
this._type = type;
|
|
this._text = text;
|
|
this._args = args;
|
|
this._location = location;
|
|
}
|
|
|
|
/**
|
|
* @return {string}
|
|
*/
|
|
type() {
|
|
return this._type;
|
|
}
|
|
|
|
/**
|
|
* @return {string}
|
|
*/
|
|
text() {
|
|
return this._text;
|
|
}
|
|
|
|
/**
|
|
* @return {!Array<!Puppeteer.JSHandle>}
|
|
*/
|
|
args() {
|
|
return this._args;
|
|
}
|
|
|
|
/**
|
|
* @return {Object}
|
|
*/
|
|
location() {
|
|
return this._location;
|
|
}
|
|
}
|
|
|
|
class FileChooser {
|
|
/**
|
|
* @param {Puppeteer.CDPSession} client
|
|
* @param {Puppeteer.ElementHandle} element
|
|
* @param {!Protocol.Page.fileChooserOpenedPayload} event
|
|
*/
|
|
constructor(client, element, event) {
|
|
this._client = client;
|
|
this._element = element;
|
|
this._multiple = event.mode !== 'selectSingle';
|
|
this._handled = false;
|
|
}
|
|
|
|
/**
|
|
* @return {boolean}
|
|
*/
|
|
isMultiple() {
|
|
return this._multiple;
|
|
}
|
|
|
|
/**
|
|
* @param {!Array<string>} filePaths
|
|
* @return {!Promise}
|
|
*/
|
|
async accept(filePaths) {
|
|
assert(!this._handled, 'Cannot accept FileChooser which is already handled!');
|
|
this._handled = true;
|
|
await this._element.uploadFile(...filePaths);
|
|
}
|
|
|
|
/**
|
|
* @return {!Promise}
|
|
*/
|
|
async cancel() {
|
|
assert(!this._handled, 'Cannot cancel FileChooser which is already handled!');
|
|
this._handled = true;
|
|
}
|
|
}
|
|
|
|
module.exports = {Page, ConsoleMessage, FileChooser};
|